About 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide
4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide (PubChem CID 135422576) has the molecular formula C9H9N3O3S2
and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide |
| PubChem CID | 135422576 |
| Molecular Formula | C9H9N3O3S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=C2/NC(=O)CS2)cc1 |
| InChI | InChI=1S/C9H9N3O3S2/c10-17(14,15)7-3-1-6(2-4-7)11-9-12-8(13)5-16-9/h1-4H,5H2,(H2,10,14,15)(H,11,12,13) |
| InChIKey | RWMDQWYQDKEGBG-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide?
The IUPAC name of 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide (CID 135422576) is 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide.
What is the SMILES notation for 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide?
The canonical SMILES for 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide is NS(=O)(=O)c1ccc(/N=C2/NC(=O)CS2)cc1.
What is the InChIKey of 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide?
The InChIKey is RWMDQWYQDKEGBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3S2/c10-17(14,15)7-3-1-6(2-4-7)11-9-12-8(13)5-16-9/h1-4H,5H2,(H2,10,14,15)(H,11,12,13).
What are the key properties of 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide?
4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide has a molecular weight of 271.32 g/mol, XLogP of 0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonamide is sourced from PubChem (CID 135422576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).