C55H43N5O2 — CID 135422805
3-pyridin-3-ylpropyl 3-(5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)propanoate (PubChem CID 135422805) has the molecular formula C55H43N5O2 and a molecular weight of 805.98 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 3-(5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)propanoate.
| Compound Name | 3-pyridin-3-ylpropyl 3-(5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)propanoate |
|---|---|
| PubChem CID | 135422805 |
| Molecular Formula | C55H43N5O2 |
| Molecular Weight | 805.98 g/mol |
| Exact Mass | 805.34 |
| IUPAC Name | 3-pyridin-3-ylpropyl 3-(5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)propanoate |
| SMILES | O=C(CCc1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1)OCCCc1cccnc1 |
| InChI | InChI=1S/C55H43N5O2/c61-50(62-34-14-16-37-15-13-33-56-36-37)32-25-42-35-49-53(40-21-9-3-10-22-40)47-29-28-45(58-47)51(38-17-5-1-6-18-38)43-26-27-44(57-43)52(39-19-7-2-8-20-39)46-30-31-48(59-46)54(55(42)60-49)41-23-11-4-12-24-41/h1-13,15,17-24,26-31,33,35-36,57,60H,14,16,25,32,34H2/b51-43-,51-45-,52-44-,52-46-,53-47-,53-49-,54-48-,55-54- |
| InChIKey | SSZSDRLYZZQWRR-DIUPPIDXSA-N |
| XLogP | 12.83 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.98 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|