C13H13ClF3N5O3 — CID 135423149
5-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-N-[(E)-methoxyiminomethyl]-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 135423149) has the molecular formula C13H13ClF3N5O3 and a molecular weight of 379.73 g/mol. Its IUPAC name is 5-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-N-[(E)-methoxyiminomethyl]-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-N-[(E)-methoxyiminomethyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135423149 |
| Molecular Formula | C13H13ClF3N5O3 |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 5-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-N-[(E)-methoxyiminomethyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | CO/N=C/NC(=O)C1=NOC(CNc2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C13H13ClF3N5O3/c1-24-21-6-20-12(23)10-3-8(25-22-10)5-19-11-9(14)2-7(4-18-11)13(15,16)17/h2,4,6,8H,3,5H2,1H3,(H,18,19)(H,20,21,23) |
| InChIKey | NQOANFHWAGWBBY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|