About 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one
2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one (PubChem CID 135423370) has the molecular formula C27H22N5O+
and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one.
Molecular Properties
| Compound Name | 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one |
| PubChem CID | 135423370 |
| Molecular Formula | C27H22N5O+ |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)n(Cc1ccc3ccccc3c1)c[n+]2Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H21N5O/c28-27-29-25-24(26(33)30-27)31(15-18-9-11-20-5-1-3-7-22(20)13-18)17-32(25)16-19-10-12-21-6-2-4-8-23(21)14-19/h1-14,17H,15-16H2,(H2-,28,29,30,33)/p+1 |
| InChIKey | JTRHECLXNJCEMT-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one?
The IUPAC name of 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one (CID 135423370) is 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one.
What is the SMILES notation for 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one?
The canonical SMILES for 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one is Nc1nc2c(c(=O)[nH]1)n(Cc1ccc3ccccc3c1)c[n+]2Cc1ccc2ccccc2c1.
What is the InChIKey of 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one?
The InChIKey is JTRHECLXNJCEMT-UHFFFAOYSA-O. The full InChI is InChI=1S/C27H21N5O/c28-27-29-25-24(26(33)30-27)31(15-18-9-11-20-5-1-3-7-22(20)13-18)17-32(25)16-19-10-12-21-6-2-4-8-23(21)14-19/h1-14,17H,15-16H2,(H2-,28,29,30,33)/p+1.
What are the key properties of 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one?
2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one has a molecular weight of 432.51 g/mol, XLogP of 4.00, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,9-bis(naphthalen-2-ylmethyl)-1H-purin-9-ium-6-one is sourced from PubChem (CID 135423370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).