C30H36BrClN4O7 — CID 135423405
ethyl (Z)-2-[7-bromo-4-chloro-2-[(2,4-dimethoxyphenyl)methyl]-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]pyrrolo[3,4-c]pyridin-3-yl]-3-hydroxyprop-2-enoate (PubChem CID 135423405) has the molecular formula C30H36BrClN4O7 and a molecular weight of 680.00 g/mol. Its IUPAC name is ethyl (Z)-2-[7-bromo-4-chloro-2-[(2,4-dimethoxyphenyl)methyl]-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]pyrrolo[3,4-c]pyridin-3-yl]-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-2-[7-bromo-4-chloro-2-[(2,4-dimethoxyphenyl)methyl]-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]pyrrolo[3,4-c]pyridin-3-yl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135423405 |
| Molecular Formula | C30H36BrClN4O7 |
| Molecular Weight | 680.00 g/mol |
| Exact Mass | 678.15 |
| IUPAC Name | ethyl (Z)-2-[7-bromo-4-chloro-2-[(2,4-dimethoxyphenyl)methyl]-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]pyrrolo[3,4-c]pyridin-3-yl]-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)/C(=C\O)c1c2c(Cl)nc(N3CCC(NC(=O)OC(C)(C)C)C3)c(Br)c2cn1Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C30H36BrClN4O7/c1-7-42-28(38)21(16-37)25-23-20(15-36(25)13-17-8-9-19(40-5)12-22(17)41-6)24(31)27(34-26(23)32)35-11-10-18(14-35)33-29(39)43-30(2,3)4/h8-9,12,15-16,18,37H,7,10-11,13-14H2,1-6H3,(H,33,39)/b21-16- |
| InChIKey | NNMDWGAZNDZDRF-PGMHBOJBSA-N |
| XLogP | 6.08 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.00 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|