About methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate
methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate (PubChem CID 135423511) has the molecular formula C22H29NO4
and a molecular weight of 371.48 g/mol. Its IUPAC name is methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate |
| PubChem CID | 135423511 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate |
| SMILES | CCCC(=O)C1=C(O)C(C(=O)OC)C(C)(C)C/C1=N\CCc1ccccc1 |
| InChI | InChI=1S/C22H29NO4/c1-5-9-17(24)18-16(23-13-12-15-10-7-6-8-11-15)14-22(2,3)19(20(18)25)21(26)27-4/h6-8,10-11,19,25H,5,9,12-14H2,1-4H3/b23-16+ |
| InChIKey | VSCOQLGILICHPB-XQNSMLJCSA-N |
| XLogP | 4.07 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate?
The IUPAC name of methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate (CID 135423511) is methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate.
What is the SMILES notation for methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate?
The canonical SMILES for methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate is CCCC(=O)C1=C(O)C(C(=O)OC)C(C)(C)C/C1=N\CCc1ccccc1.
What is the InChIKey of methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate?
The InChIKey is VSCOQLGILICHPB-XQNSMLJCSA-N. The full InChI is InChI=1S/C22H29NO4/c1-5-9-17(24)18-16(23-13-12-15-10-7-6-8-11-15)14-22(2,3)19(20(18)25)21(26)27-4/h6-8,10-11,19,25H,5,9,12-14H2,1-4H3/b23-16+.
What are the key properties of methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate?
methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate has a molecular weight of 371.48 g/mol, XLogP of 4.07, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(2-phenylethylimino)cyclohex-2-ene-1-carboxylate is sourced from PubChem (CID 135423511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).