C18H11NO3 — CID 135423664
(16Z)-16-(1-hydroxyethylidene)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaene-8,15-dione (PubChem CID 135423664) has the molecular formula C18H11NO3 and a molecular weight of 289.29 g/mol. Its IUPAC name is (16Z)-16-(1-hydroxyethylidene)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaene-8,15-dione.
| Compound Name | (16Z)-16-(1-hydroxyethylidene)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaene-8,15-dione |
|---|---|
| PubChem CID | 135423664 |
| Molecular Formula | C18H11NO3 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (16Z)-16-(1-hydroxyethylidene)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaene-8,15-dione |
| SMILES | C/C(O)=c1/c(=O)nc2cccc3c2=c1c1ccccc1c3=O |
| InChI | InChI=1S/C18H11NO3/c1-9(20)14-16-10-5-2-3-6-11(10)17(21)12-7-4-8-13(15(12)16)19-18(14)22/h2-8,20H,1H3/b14-9- |
| InChIKey | ZZMAHQZJJAGKMN-ZROIWOOFSA-N |
| XLogP | 1.68 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |