C17H15N5S — CID 135423771
N-methyl-5-(1H-pyrrol-3-yl)-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine (PubChem CID 135423771) has the molecular formula C17H15N5S and a molecular weight of 321.41 g/mol. Its IUPAC name is N-methyl-5-(1H-pyrrol-3-yl)-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine.
| Compound Name | N-methyl-5-(1H-pyrrol-3-yl)-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 135423771 |
| Molecular Formula | C17H15N5S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-methyl-5-(1H-pyrrol-3-yl)-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
| SMILES | C/N=C1\Nc2ncccc2C(c2cc[nH]c2)=NC1c1cccs1 |
| InChI | InChI=1S/C17H15N5S/c1-18-17-15(13-5-3-9-23-13)21-14(11-6-8-19-10-11)12-4-2-7-20-16(12)22-17/h2-10,15,19H,1H3,(H,18,20,22) |
| InChIKey | NNSLEHYATBPAJW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|