C20H27N7S2 — CID 135423915
5-[2-(diethylamino)-5-phenyldiazenyl-1,3-thiazol-4-yl]-2-N,2-N-diethyl-1,3-thiazole-2,4-diamine (PubChem CID 135423915) has the molecular formula C20H27N7S2 and a molecular weight of 429.62 g/mol. Its IUPAC name is 5-[2-(diethylamino)-5-phenyldiazenyl-1,3-thiazol-4-yl]-2-N,2-N-diethyl-1,3-thiazole-2,4-diamine.
| Compound Name | 5-[2-(diethylamino)-5-phenyldiazenyl-1,3-thiazol-4-yl]-2-N,2-N-diethyl-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 135423915 |
| Molecular Formula | C20H27N7S2 |
| Molecular Weight | 429.62 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 5-[2-(diethylamino)-5-phenyldiazenyl-1,3-thiazol-4-yl]-2-N,2-N-diethyl-1,3-thiazole-2,4-diamine |
| SMILES | CCN(CC)c1nc(-c2sc(N(CC)CC)nc2N)c(/N=N/c2ccccc2)s1 |
| InChI | InChI=1S/C20H27N7S2/c1-5-26(6-2)19-22-15(16-17(21)23-20(28-16)27(7-3)8-4)18(29-19)25-24-14-12-10-9-11-13-14/h9-13H,5-8,21H2,1-4H3/b25-24+ |
| InChIKey | FATIJOKCABGZRH-OCOZRVBESA-N |
| XLogP | 5.96 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|