C20H24N6O4S — CID 135423930
ethyl N-[[3-(1,3-dimethyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-4-propoxyphenyl]carbamothioyl]carbamate (PubChem CID 135423930) has the molecular formula C20H24N6O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is ethyl N-[[3-(1,3-dimethyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-4-propoxyphenyl]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[3-(1,3-dimethyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-4-propoxyphenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 135423930 |
| Molecular Formula | C20H24N6O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | ethyl N-[[3-(1,3-dimethyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-4-propoxyphenyl]carbamothioyl]carbamate |
| SMILES | CCCOc1ccc(NC(=S)NC(=O)OCC)cc1-c1nc2c(c(C)nn2C)c(=O)[nH]1 |
| InChI | InChI=1S/C20H24N6O4S/c1-5-9-30-14-8-7-12(21-19(31)24-20(28)29-6-2)10-13(14)16-22-17-15(18(27)23-16)11(3)25-26(17)4/h7-8,10H,5-6,9H2,1-4H3,(H,22,23,27)(H2,21,24,28,31) |
| InChIKey | GTJIAMAJUZVCPV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|