C57H54N4O2 — CID 135424104
4-[10,15,20-tris(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 135424104) has the molecular formula C57H54N4O2 and a molecular weight of 827.09 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15,20-tris(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 135424104 |
| Molecular Formula | C57H54N4O2 |
| Molecular Weight | 827.09 g/mol |
| Exact Mass | 826.42 |
| IUPAC Name | 4-[10,15,20-tris(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(C(C)(C)C)cc4)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4nc(c(-c5ccc(C(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C57H54N4O2/c1-55(2,3)39-20-14-35(15-21-39)51-44-28-26-42(58-44)50(34-10-12-38(13-11-34)54(62)63)43-27-29-45(59-43)52(36-16-22-40(23-17-36)56(4,5)6)47-31-33-49(61-47)53(48-32-30-46(51)60-48)37-18-24-41(25-19-37)57(7,8)9/h10-33,58,61H,1-9H3,(H,62,63)/b50-42-,50-43-,51-44-,51-46-,52-45-,52-47-,53-48-,53-49- |
| InChIKey | PFJHZGIOZLELDW-APYASCQISA-N |
| XLogP | 14.91 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.09 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |