C19H15BrN4O3 — CID 135424159
6-bromo-2-[3-hydroxy-5-imino-1-(4-methoxyphenyl)-2H-pyrrol-4-yl]-3H-quinazolin-4-one (PubChem CID 135424159) has the molecular formula C19H15BrN4O3 and a molecular weight of 427.26 g/mol. Its IUPAC name is 6-bromo-2-[3-hydroxy-5-imino-1-(4-methoxyphenyl)-2H-pyrrol-4-yl]-3H-quinazolin-4-one.
| Compound Name | 6-bromo-2-[3-hydroxy-5-imino-1-(4-methoxyphenyl)-2H-pyrrol-4-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135424159 |
| Molecular Formula | C19H15BrN4O3 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 6-bromo-2-[3-hydroxy-5-imino-1-(4-methoxyphenyl)-2H-pyrrol-4-yl]-3H-quinazolin-4-one |
| SMILES | [H]/N=C1/C(c2nc3ccc(Br)cc3c(=O)[nH]2)=C(O)CN1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H15BrN4O3/c1-27-12-5-3-11(4-6-12)24-9-15(25)16(17(24)21)18-22-14-7-2-10(20)8-13(14)19(26)23-18/h2-8,21,25H,9H2,1H3,(H,22,23,26)/b21-17- |
| InChIKey | HJBWCGLIAAGMNB-FXBPSFAMSA-N |
| XLogP | 3.46 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|