C34H35F5N6 — CID 135424543
(2,2,7,7,12,12,17,17-octamethyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),3(24),5,8,10,13,15,18-octaen-5-yl)-(2,3,4,5,6-pentafluorophenyl)diazene (PubChem CID 135424543) has the molecular formula C34H35F5N6 and a molecular weight of 622.69 g/mol. Its IUPAC name is (2,2,7,7,12,12,17,17-octamethyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),3(24),5,8,10,13,15,18-octaen-5-yl)-(2,3,4,5,6-pentafluorophenyl)diazene.
| Compound Name | (2,2,7,7,12,12,17,17-octamethyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),3(24),5,8,10,13,15,18-octaen-5-yl)-(2,3,4,5,6-pentafluorophenyl)diazene |
|---|---|
| PubChem CID | 135424543 |
| Molecular Formula | C34H35F5N6 |
| Molecular Weight | 622.69 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | (2,2,7,7,12,12,17,17-octamethyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),3(24),5,8,10,13,15,18-octaen-5-yl)-(2,3,4,5,6-pentafluorophenyl)diazene |
| SMILES | CC1(C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(C)c2cc([nH]c2/N=N/c2c(F)c(F)c(F)c(F)c2F)C(C)(C)c2ccc1[nH]2 |
| InChI | InChI=1S/C34H35F5N6/c1-31(2)16-15-23(43-30(16)45-44-29-27(38)25(36)24(35)26(37)28(29)39)34(7,8)22-14-13-21(42-22)33(5,6)20-12-11-19(41-20)32(3,4)18-10-9-17(31)40-18/h9-15,40-43H,1-8H3/b45-44+ |
| InChIKey | DZYBEWUUACWCHL-JQOKOOLQSA-N |
| XLogP | 9.73 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.69 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|