About (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide
(E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide (PubChem CID 135424818) has the molecular formula C18H14N2O4
and a molecular weight of 322.32 g/mol. Its IUPAC name is (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide |
| PubChem CID | 135424818 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide |
| SMILES | O=NC(=O)/C=C/c1ccc2c(O)n(Cc3ccccc3)c(O)c2c1 |
| InChI | InChI=1S/C18H14N2O4/c21-16(19-24)9-7-12-6-8-14-15(10-12)18(23)20(17(14)22)11-13-4-2-1-3-5-13/h1-10,22-23H,11H2/b9-7+ |
| InChIKey | CTLWCHYRCGMALV-VQHVLOKHSA-N |
| XLogP | 3.41 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide?
The IUPAC name of (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide (CID 135424818) is (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide.
What is the SMILES notation for (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide?
The canonical SMILES for (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide is O=NC(=O)/C=C/c1ccc2c(O)n(Cc3ccccc3)c(O)c2c1.
What is the InChIKey of (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide?
The InChIKey is CTLWCHYRCGMALV-VQHVLOKHSA-N. The full InChI is InChI=1S/C18H14N2O4/c21-16(19-24)9-7-12-6-8-14-15(10-12)18(23)20(17(14)22)11-13-4-2-1-3-5-13/h1-10,22-23H,11H2/b9-7+.
What are the key properties of (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide?
(E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide has a molecular weight of 322.32 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2-benzyl-1,3-dihydroxyisoindol-5-yl)-N-oxoprop-2-enamide is sourced from PubChem (CID 135424818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).