C21H20N4O4S2 — CID 135425018
(5E)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 135425018) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is (5E)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 135425018 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (5E)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)c1ccc(/C=C2/SC(=O)N(CC/N=C3\NS(=O)(=O)c4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C21H20N4O4S2/c1-24(2)15-9-7-14(8-10-15)13-17-20(26)25(21(27)30-17)12-11-22-19-16-5-3-4-6-18(16)31(28,29)23-19/h3-10,13H,11-12H2,1-2H3,(H,22,23)/b17-13+ |
| InChIKey | NKRZBFUIJCHANP-GHRIWEEISA-N |
| XLogP | 2.53 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|