About 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one
3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one (PubChem CID 135425120) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one |
| PubChem CID | 135425120 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one |
| SMILES | CCc1cc(-c2ncn[nH]2)c(C)[nH]c1=O |
| InChI | InChI=1S/C10H12N4O/c1-3-7-4-8(6(2)13-10(7)15)9-11-5-12-14-9/h4-5H,3H2,1-2H3,(H,13,15)(H,11,12,14) |
| InChIKey | OWOAPSCGTDMSSH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one?
The IUPAC name of 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one (CID 135425120) is 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one.
What is the SMILES notation for 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one?
The canonical SMILES for 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one is CCc1cc(-c2ncn[nH]2)c(C)[nH]c1=O.
What is the InChIKey of 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one?
The InChIKey is OWOAPSCGTDMSSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-3-7-4-8(6(2)13-10(7)15)9-11-5-12-14-9/h4-5H,3H2,1-2H3,(H,13,15)(H,11,12,14).
What are the key properties of 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one?
3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one has a molecular weight of 204.23 g/mol, XLogP of 1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-methyl-5-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one is sourced from PubChem (CID 135425120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).