C17H14N4S2 — CID 135425186
N-methyl-3,5-dithiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine (PubChem CID 135425186) has the molecular formula C17H14N4S2 and a molecular weight of 338.46 g/mol. Its IUPAC name is N-methyl-3,5-dithiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine.
| Compound Name | N-methyl-3,5-dithiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 135425186 |
| Molecular Formula | C17H14N4S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-methyl-3,5-dithiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
| SMILES | C/N=C1\Nc2ncccc2C(c2cccs2)=NC1c1cccs1 |
| InChI | InChI=1S/C17H14N4S2/c1-18-17-15(13-7-4-10-23-13)20-14(12-6-3-9-22-12)11-5-2-8-19-16(11)21-17/h2-10,15H,1H3,(H,18,19,21) |
| InChIKey | JBRNKNLCAPYPAD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|