About 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine
7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine (PubChem CID 135425521) has the molecular formula C20H13F2N3
and a molecular weight of 333.34 g/mol. Its IUPAC name is 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine.
Molecular Properties
| Compound Name | 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine |
| PubChem CID | 135425521 |
| Molecular Formula | C20H13F2N3 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine |
| SMILES | Fc1ccc(C2=Nc3ccc(F)cc3C(c3ccccc3)=NN2)cc1 |
| InChI | InChI=1S/C20H13F2N3/c21-15-8-6-14(7-9-15)20-23-18-11-10-16(22)12-17(18)19(24-25-20)13-4-2-1-3-5-13/h1-12H,(H,23,25) |
| InChIKey | CRTIMRYWEANVEZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine?
The IUPAC name of 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine (CID 135425521) is 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine.
What is the SMILES notation for 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine?
The canonical SMILES for 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine is Fc1ccc(C2=Nc3ccc(F)cc3C(c3ccccc3)=NN2)cc1.
What is the InChIKey of 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine?
The InChIKey is CRTIMRYWEANVEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F2N3/c21-15-8-6-14(7-9-15)20-23-18-11-10-16(22)12-17(18)19(24-25-20)13-4-2-1-3-5-13/h1-12H,(H,23,25).
What are the key properties of 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine?
7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine has a molecular weight of 333.34 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-(4-fluorophenyl)-5-phenyl-3H-1,3,4-benzotriazepine is sourced from PubChem (CID 135425521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).