C24H21ClFN3O2 — CID 135425675
7-chloro-5-(3,4-diethoxyphenyl)-2-(4-fluorophenyl)-3H-1,3,4-benzotriazepine (PubChem CID 135425675) has the molecular formula C24H21ClFN3O2 and a molecular weight of 437.90 g/mol. Its IUPAC name is 7-chloro-5-(3,4-diethoxyphenyl)-2-(4-fluorophenyl)-3H-1,3,4-benzotriazepine.
| Compound Name | 7-chloro-5-(3,4-diethoxyphenyl)-2-(4-fluorophenyl)-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135425675 |
| Molecular Formula | C24H21ClFN3O2 |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 7-chloro-5-(3,4-diethoxyphenyl)-2-(4-fluorophenyl)-3H-1,3,4-benzotriazepine |
| SMILES | CCOc1ccc(C2=NNC(c3ccc(F)cc3)=Nc3ccc(Cl)cc32)cc1OCC |
| InChI | InChI=1S/C24H21ClFN3O2/c1-3-30-21-12-7-16(13-22(21)31-4-2)23-19-14-17(25)8-11-20(19)27-24(29-28-23)15-5-9-18(26)10-6-15/h5-14H,3-4H2,1-2H3,(H,27,29) |
| InChIKey | DYITWACWASDXRS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |