C24H25N3O2S — CID 135425693
5-(3,4-diethoxyphenyl)-7-ethyl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135425693) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 5-(3,4-diethoxyphenyl)-7-ethyl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 5-(3,4-diethoxyphenyl)-7-ethyl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135425693 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 5-(3,4-diethoxyphenyl)-7-ethyl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | CCOc1ccc(C2=NNC(c3cccs3)=Nc3ccc(CC)cc32)cc1OCC |
| InChI | InChI=1S/C24H25N3O2S/c1-4-16-9-11-19-18(14-16)23(26-27-24(25-19)22-8-7-13-30-22)17-10-12-20(28-5-2)21(15-17)29-6-3/h7-15H,4-6H2,1-3H3,(H,25,27) |
| InChIKey | WUIGBZOPIYKEID-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |