C20H16ClN3O2S — CID 135425786
7-chloro-5-(3,4-dimethoxyphenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135425786) has the molecular formula C20H16ClN3O2S and a molecular weight of 397.89 g/mol. Its IUPAC name is 7-chloro-5-(3,4-dimethoxyphenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 7-chloro-5-(3,4-dimethoxyphenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135425786 |
| Molecular Formula | C20H16ClN3O2S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 7-chloro-5-(3,4-dimethoxyphenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | COc1ccc(C2=NNC(c3cccs3)=Nc3ccc(Cl)cc32)cc1OC |
| InChI | InChI=1S/C20H16ClN3O2S/c1-25-16-8-5-12(10-17(16)26-2)19-14-11-13(21)6-7-15(14)22-20(24-23-19)18-4-3-9-27-18/h3-11H,1-2H3,(H,22,24) |
| InChIKey | RUCCRGOTOCENTD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |