C18H14N4O — CID 135426534
2-methyl-6,7-diphenyl-4H-imidazo[1,2-b][1,2,4]triazin-3-one (PubChem CID 135426534) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-methyl-6,7-diphenyl-4H-imidazo[1,2-b][1,2,4]triazin-3-one.
| Compound Name | 2-methyl-6,7-diphenyl-4H-imidazo[1,2-b][1,2,4]triazin-3-one |
|---|---|
| PubChem CID | 135426534 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-methyl-6,7-diphenyl-4H-imidazo[1,2-b][1,2,4]triazin-3-one |
| SMILES | Cc1nn2c(-c3ccccc3)c(-c3ccccc3)nc2[nH]c1=O |
| InChI | InChI=1S/C18H14N4O/c1-12-17(23)20-18-19-15(13-8-4-2-5-9-13)16(22(18)21-12)14-10-6-3-7-11-14/h2-11H,1H3,(H,19,20,23) |
| InChIKey | QQLYLHHIGYCBCA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |