About 6-oxo-1,7-dihydropurine-8-diazonium
6-oxo-1,7-dihydropurine-8-diazonium (PubChem CID 135426536) has the molecular formula C5H3N6O+
and a molecular weight of 163.12 g/mol. Its IUPAC name is 6-oxo-1,7-dihydropurine-8-diazonium.
Molecular Properties
| Compound Name | 6-oxo-1,7-dihydropurine-8-diazonium |
| PubChem CID | 135426536 |
| Molecular Formula | C5H3N6O+ |
| Molecular Weight | 163.12 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 6-oxo-1,7-dihydropurine-8-diazonium |
| SMILES | N#[N+]c1nc2nc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C5H2N6O/c6-11-5-9-2-3(10-5)7-1-8-4(2)12/h1,6H/p+1 |
| InChIKey | FPUHXOALOZPZQS-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.12 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-1,7-dihydropurine-8-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-1,7-dihydropurine-8-diazonium?
The IUPAC name of 6-oxo-1,7-dihydropurine-8-diazonium (CID 135426536) is 6-oxo-1,7-dihydropurine-8-diazonium.
What is the SMILES notation for 6-oxo-1,7-dihydropurine-8-diazonium?
The canonical SMILES for 6-oxo-1,7-dihydropurine-8-diazonium is N#[N+]c1nc2nc[nH]c(=O)c2[nH]1.
What is the InChIKey of 6-oxo-1,7-dihydropurine-8-diazonium?
The InChIKey is FPUHXOALOZPZQS-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H2N6O/c6-11-5-9-2-3(10-5)7-1-8-4(2)12/h1,6H/p+1.
What are the key properties of 6-oxo-1,7-dihydropurine-8-diazonium?
6-oxo-1,7-dihydropurine-8-diazonium has a molecular weight of 163.12 g/mol, XLogP of 0.13, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-1,7-dihydropurine-8-diazonium is sourced from PubChem (CID 135426536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).