C14H18N4O6S — CID 135426635
2-[2-(2,3,4,5,6-pentahydroxyhexylidene)hydrazinyl]-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one (PubChem CID 135426635) has the molecular formula C14H18N4O6S and a molecular weight of 370.39 g/mol. Its IUPAC name is 2-[2-(2,3,4,5,6-pentahydroxyhexylidene)hydrazinyl]-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one.
| Compound Name | 2-[2-(2,3,4,5,6-pentahydroxyhexylidene)hydrazinyl]-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135426635 |
| Molecular Formula | C14H18N4O6S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-[2-(2,3,4,5,6-pentahydroxyhexylidene)hydrazinyl]-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
| SMILES | O=C1NC(NN=CC(O)C(O)C(O)C(O)CO)=NC1=Cc1cccs1 |
| InChI | InChI=1S/C14H18N4O6S/c19-6-10(21)12(23)11(22)9(20)5-15-18-14-16-8(13(24)17-14)4-7-2-1-3-25-7/h1-5,9-12,19-23H,6H2,(H2,16,17,18,24) |
| InChIKey | MAGJUPNOVKSNDM-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|