About 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one
3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one (PubChem CID 135426729) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one.
Molecular Properties
| Compound Name | 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one |
| PubChem CID | 135426729 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one |
| SMILES | Cc1c(-c2ccccc2)[nH]c2cn[nH]c(=O)c12 |
| InChI | InChI=1S/C13H11N3O/c1-8-11-10(7-14-16-13(11)17)15-12(8)9-5-3-2-4-6-9/h2-7,15H,1H3,(H,16,17) |
| InChIKey | DPTXIPYEVFMFTE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one?
The IUPAC name of 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one (CID 135426729) is 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one.
What is the SMILES notation for 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one?
The canonical SMILES for 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one is Cc1c(-c2ccccc2)[nH]c2cn[nH]c(=O)c12.
What is the InChIKey of 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one?
The InChIKey is DPTXIPYEVFMFTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c1-8-11-10(7-14-16-13(11)17)15-12(8)9-5-3-2-4-6-9/h2-7,15H,1H3,(H,16,17).
What are the key properties of 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one?
3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one has a molecular weight of 225.25 g/mol, XLogP of 2.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-phenyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one is sourced from PubChem (CID 135426729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).