C21H21N5O — CID 135427164
2-benzylimino-8-methyl-4-(4-methylphenyl)-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one (PubChem CID 135427164) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-benzylimino-8-methyl-4-(4-methylphenyl)-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one.
| Compound Name | 2-benzylimino-8-methyl-4-(4-methylphenyl)-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 135427164 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-benzylimino-8-methyl-4-(4-methylphenyl)-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one |
| SMILES | Cc1ccc(C2N/C(=N/Cc3ccccc3)Nc3nc(C)cc(=O)n32)cc1 |
| InChI | InChI=1S/C21H21N5O/c1-14-8-10-17(11-9-14)19-24-20(22-13-16-6-4-3-5-7-16)25-21-23-15(2)12-18(27)26(19)21/h3-12,19H,13H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | YLJSHUSEFTUBCI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|