C20H19N5O — CID 135427165
2-benzylimino-8-methyl-4-phenyl-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one (PubChem CID 135427165) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 2-benzylimino-8-methyl-4-phenyl-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one.
| Compound Name | 2-benzylimino-8-methyl-4-phenyl-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 135427165 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-benzylimino-8-methyl-4-phenyl-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one |
| SMILES | Cc1cc(=O)n2c(n1)N/C(=N\Cc1ccccc1)NC2c1ccccc1 |
| InChI | InChI=1S/C20H19N5O/c1-14-12-17(26)25-18(16-10-6-3-7-11-16)23-19(24-20(25)22-14)21-13-15-8-4-2-5-9-15/h2-12,18H,13H2,1H3,(H2,21,22,23,24) |
| InChIKey | NQRYQBNILYHWHG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|