C15H11N3O — CID 135427225
4,6-diphenyl-1H-1,3,5-triazin-2-one (PubChem CID 135427225) has the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. Its IUPAC name is 4,6-diphenyl-1H-1,3,5-triazin-2-one.
| Compound Name | 4,6-diphenyl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135427225 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4,6-diphenyl-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(-c2ccccc2)nc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C15H11N3O/c19-15-17-13(11-7-3-1-4-8-11)16-14(18-15)12-9-5-2-6-10-12/h1-10H,(H,16,17,18,19) |
| InChIKey | KODLDJGSBFMSDG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |