C7H5N5O4 — CID 135427573
7-nitro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine (PubChem CID 135427573) has the molecular formula C7H5N5O4 and a molecular weight of 223.15 g/mol. Its IUPAC name is 7-nitro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine.
| Compound Name | 7-nitro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
|---|---|
| PubChem CID | 135427573 |
| Molecular Formula | C7H5N5O4 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 7-nitro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
| SMILES | Nc1n[n+]([O-])c2cc([N+](=O)[O-])ccc2[n+]1[O-] |
| InChI | InChI=1S/C7H5N5O4/c8-7-9-11(14)6-3-4(12(15)16)1-2-5(6)10(7)13/h1-3H,(H2,8,9) |
| InChIKey | OJMWWLBHDZZSMF-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|