About 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol
3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol (PubChem CID 135427580) has the molecular formula C15H25N7O2
and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol |
| PubChem CID | 135427580 |
| Molecular Formula | C15H25N7O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol |
| SMILES | [H]/N=c1\ncn(CC(O)CO)c2nc(N3CCN(CCC)CC3)[nH]c12 |
| InChI | InChI=1S/C15H25N7O2/c1-2-3-20-4-6-21(7-5-20)15-18-12-13(16)17-10-22(14(12)19-15)8-11(24)9-23/h10-11,16,23-24H,2-9H2,1H3,(H,18,19)/b16-13- |
| InChIKey | FGVJTGHXAAJTLF-SSZFMOIBSA-N |
| XLogP | -0.88 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol?
The IUPAC name of 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol (CID 135427580) is 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol.
What is the SMILES notation for 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol?
The canonical SMILES for 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol is [H]/N=c1\ncn(CC(O)CO)c2nc(N3CCN(CCC)CC3)[nH]c12.
What is the InChIKey of 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol?
The InChIKey is FGVJTGHXAAJTLF-SSZFMOIBSA-N. The full InChI is InChI=1S/C15H25N7O2/c1-2-3-20-4-6-21(7-5-20)15-18-12-13(16)17-10-22(14(12)19-15)8-11(24)9-23/h10-11,16,23-24H,2-9H2,1H3,(H,18,19)/b16-13-.
What are the key properties of 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol?
3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol has a molecular weight of 335.41 g/mol, XLogP of -0.88, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol is sourced from PubChem (CID 135427580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).