About 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide
4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide (PubChem CID 135427646) has the molecular formula C10H17N5O3S
and a molecular weight of 287.35 g/mol. Its IUPAC name is 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide |
| PubChem CID | 135427646 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide |
| SMILES | Cc1nc(C)c(N2CCN(S(N)(=O)=O)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H17N5O3S/c1-7-9(10(16)13-8(2)12-7)14-3-5-15(6-4-14)19(11,17)18/h3-6H2,1-2H3,(H2,11,17,18)(H,12,13,16) |
| InChIKey | QBHYVAWKFRUONU-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide?
The IUPAC name of 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide (CID 135427646) is 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide.
What is the SMILES notation for 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide?
The canonical SMILES for 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide is Cc1nc(C)c(N2CCN(S(N)(=O)=O)CC2)c(=O)[nH]1.
What is the InChIKey of 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide?
The InChIKey is QBHYVAWKFRUONU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O3S/c1-7-9(10(16)13-8(2)12-7)14-3-5-15(6-4-14)19(11,17)18/h3-6H2,1-2H3,(H2,11,17,18)(H,12,13,16).
What are the key properties of 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide?
4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide has a molecular weight of 287.35 g/mol, XLogP of -1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)piperazine-1-sulfonamide is sourced from PubChem (CID 135427646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).