About 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol
4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol (PubChem CID 135428027) has the molecular formula C32H22N4O
and a molecular weight of 478.56 g/mol. Its IUPAC name is 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol.
Molecular Properties
| Compound Name | 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol |
| PubChem CID | 135428027 |
| Molecular Formula | C32H22N4O |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol |
| SMILES | Oc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccccc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C32H22N4O/c37-26-12-6-21(7-13-26)32-29-16-10-24(35-29)18-22-8-14-27(33-22)31(20-4-2-1-3-5-20)28-15-9-23(34-28)19-25-11-17-30(32)36-25/h1-19,33,36-37H/b22-18-,23-19-,24-18-,25-19-,31-27-,31-28-,32-29-,32-30- |
| InChIKey | VHHTYYIMWHZHPJ-IYNIXLDNSA-N |
| XLogP | 7.70 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol?
The IUPAC name of 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol (CID 135428027) is 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol.
What is the SMILES notation for 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol?
The canonical SMILES for 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol is Oc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccccc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1.
What is the InChIKey of 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol?
The InChIKey is VHHTYYIMWHZHPJ-IYNIXLDNSA-N. The full InChI is InChI=1S/C32H22N4O/c37-26-12-6-21(7-13-26)32-29-16-10-24(35-29)18-22-8-14-27(33-22)31(20-4-2-1-3-5-20)28-15-9-23(34-28)19-25-11-17-30(32)36-25/h1-19,33,36-37H/b22-18-,23-19-,24-18-,25-19-,31-27-,31-28-,32-29-,32-30-.
What are the key properties of 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol?
4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol has a molecular weight of 478.56 g/mol, XLogP of 7.70, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(15-phenyl-21,23-dihydroporphyrin-5-yl)phenol is sourced from PubChem (CID 135428027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).