C54H46N4O4 — CID 135428069
methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 135428069) has the molecular formula C54H46N4O4 and a molecular weight of 814.99 g/mol. Its IUPAC name is methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135428069 |
| Molecular Formula | C54H46N4O4 |
| Molecular Weight | 814.99 g/mol |
| Exact Mass | 814.35 |
| IUPAC Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C54H46N4O4/c1-29-25-31(3)47(32(4)26-29)51-43-21-17-39(55-43)49(35-9-13-37(14-10-35)53(59)61-7)41-19-23-45(57-41)52(48-33(5)27-30(2)28-34(48)6)46-24-20-42(58-46)50(40-18-22-44(51)56-40)36-11-15-38(16-12-36)54(60)62-8/h9-28,55,58H,1-8H3/b49-39-,49-41-,50-40-,50-42-,51-43+,51-44+,52-45+,52-46+ |
| InChIKey | UXQHBVUUPMJEEM-ZABGCZTGSA-N |
| XLogP | 12.75 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.99 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |