C20H19N3O2 — CID 135428148
15-[2-(dimethylamino)ethyl]-14-hydroxy-8-imino-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaen-16-one (PubChem CID 135428148) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 15-[2-(dimethylamino)ethyl]-14-hydroxy-8-imino-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaen-16-one.
| Compound Name | 15-[2-(dimethylamino)ethyl]-14-hydroxy-8-imino-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaen-16-one |
|---|---|
| PubChem CID | 135428148 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 15-[2-(dimethylamino)ethyl]-14-hydroxy-8-imino-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaen-16-one |
| SMILES | [H]/N=C1\c2ccccc2-c2c(=O)n(CCN(C)C)c(O)c3cccc1c23 |
| InChI | InChI=1S/C20H19N3O2/c1-22(2)10-11-23-19(24)15-9-5-8-14-16(15)17(20(23)25)12-6-3-4-7-13(12)18(14)21/h3-9,21,24H,10-11H2,1-2H3/b21-18+ |
| InChIKey | ZPOTUSOXKPNVQF-DYTRJAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|