C15H22O4 — CID 135428660
methyl (4aS,8aR)-6-hydroxy-2,2,7-trimethyl-8-oxo-3,4,5,8a-tetrahydro-1H-naphthalene-4a-carboxylate (PubChem CID 135428660) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl (4aS,8aR)-6-hydroxy-2,2,7-trimethyl-8-oxo-3,4,5,8a-tetrahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4aS,8aR)-6-hydroxy-2,2,7-trimethyl-8-oxo-3,4,5,8a-tetrahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 135428660 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl (4aS,8aR)-6-hydroxy-2,2,7-trimethyl-8-oxo-3,4,5,8a-tetrahydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)C[C@H]1C(=O)C(C)=C(O)C2 |
| InChI | InChI=1S/C15H22O4/c1-9-11(16)8-15(13(18)19-4)6-5-14(2,3)7-10(15)12(9)17/h10,16H,5-8H2,1-4H3/t10-,15-/m0/s1 |
| InChIKey | KGEHEKIVSGKXER-BONVTDFDSA-N |
| XLogP | 2.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |