C10H9NO4S — CID 135428666
(4S)-2-(2,5-dihydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 135428666) has the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. Its IUPAC name is (4S)-2-(2,5-dihydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-(2,5-dihydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 135428666 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (4S)-2-(2,5-dihydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)[C@H]1CSC(c2cc(O)ccc2O)=N1 |
| InChI | InChI=1S/C10H9NO4S/c12-5-1-2-8(13)6(3-5)9-11-7(4-16-9)10(14)15/h1-3,7,12-13H,4H2,(H,14,15)/t7-/m1/s1 |
| InChIKey | UZKPUFNAUXBOOI-SSDOTTSWSA-N |
| XLogP | 1.04 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|