C10H11F2N3O2S — CID 135428940
6,7-difluoro-1,1-dioxo-N-propan-2-yl-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135428940) has the molecular formula C10H11F2N3O2S and a molecular weight of 275.28 g/mol. Its IUPAC name is 6,7-difluoro-1,1-dioxo-N-propan-2-yl-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 6,7-difluoro-1,1-dioxo-N-propan-2-yl-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135428940 |
| Molecular Formula | C10H11F2N3O2S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 6,7-difluoro-1,1-dioxo-N-propan-2-yl-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CC(C)/N=C1\Nc2cc(F)c(F)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C10H11F2N3O2S/c1-5(2)13-10-14-8-3-6(11)7(12)4-9(8)18(16,17)15-10/h3-5H,1-2H3,(H2,13,14,15) |
| InChIKey | WRBQGMGYUTVLFN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|