C17H10FN3O2 — CID 135429375
4-fluoro-2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)phenol (PubChem CID 135429375) has the molecular formula C17H10FN3O2 and a molecular weight of 307.28 g/mol. Its IUPAC name is 4-fluoro-2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)phenol.
| Compound Name | 4-fluoro-2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)phenol |
|---|---|
| PubChem CID | 135429375 |
| Molecular Formula | C17H10FN3O2 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 4-fluoro-2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)phenol |
| SMILES | Oc1ccc(F)cc1-c1nc(-c2nccc3ccccc23)no1 |
| InChI | InChI=1S/C17H10FN3O2/c18-11-5-6-14(22)13(9-11)17-20-16(21-23-17)15-12-4-2-1-3-10(12)7-8-19-15/h1-9,22H |
| InChIKey | MVCUKFSNEXHXRA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |