C19H27NO3 — CID 135429776
5-acetyl-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxy-3,4-dimethylpyridin-2-one (PubChem CID 135429776) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 5-acetyl-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxy-3,4-dimethylpyridin-2-one.
| Compound Name | 5-acetyl-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxy-3,4-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 135429776 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 5-acetyl-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxy-3,4-dimethylpyridin-2-one |
| SMILES | CC(=O)c1c(C)c(C)c(=O)n(C/C=C(\C)CCC=C(C)C)c1O |
| InChI | InChI=1S/C19H27NO3/c1-12(2)8-7-9-13(3)10-11-20-18(22)15(5)14(4)17(16(6)21)19(20)23/h8,10,23H,7,9,11H2,1-6H3/b13-10+ |
| InChIKey | IXLSOOWWYWSCIU-JLHYYAGUSA-N |
| XLogP | 4.07 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|