C12H15N3OS — CID 135429881
3-benzylsulfanyl-6,6-dimethyl-1,4-dihydro-1,2,4-triazin-5-one (PubChem CID 135429881) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-benzylsulfanyl-6,6-dimethyl-1,4-dihydro-1,2,4-triazin-5-one.
| Compound Name | 3-benzylsulfanyl-6,6-dimethyl-1,4-dihydro-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135429881 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-benzylsulfanyl-6,6-dimethyl-1,4-dihydro-1,2,4-triazin-5-one |
| SMILES | CC1(C)NN=C(SCc2ccccc2)NC1=O |
| InChI | InChI=1S/C12H15N3OS/c1-12(2)10(16)13-11(14-15-12)17-8-9-6-4-3-5-7-9/h3-7,15H,8H2,1-2H3,(H,13,14,16) |
| InChIKey | LKCYDITVYNZTTR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |