About 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine
9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine (PubChem CID 135429898) has the molecular formula C22H13N5
and a molecular weight of 347.38 g/mol. Its IUPAC name is 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine.
Molecular Properties
| Compound Name | 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine |
| PubChem CID | 135429898 |
| Molecular Formula | C22H13N5 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine |
| SMILES | [H]/N=c1\nc(-c2ccccc2)nc2[nH]c3c4cccc5cccc(c3nc12)c54 |
| InChI | InChI=1S/C22H13N5/c23-20-19-22(27-21(26-20)13-6-2-1-3-7-13)25-18-15-11-5-9-12-8-4-10-14(16(12)15)17(18)24-19/h1-11H,(H2,23,25,26,27) |
| InChIKey | GVUHZTTYZGRNIV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine?
The IUPAC name of 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine (CID 135429898) is 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine.
What is the SMILES notation for 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine?
The canonical SMILES for 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine is [H]/N=c1\nc(-c2ccccc2)nc2[nH]c3c4cccc5cccc(c3nc12)c54.
What is the InChIKey of 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine?
The InChIKey is GVUHZTTYZGRNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13N5/c23-20-19-22(27-21(26-20)13-6-2-1-3-7-13)25-18-15-11-5-9-12-8-4-10-14(16(12)15)17(18)24-19/h1-11H,(H2,23,25,26,27).
What are the key properties of 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine?
9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine has a molecular weight of 347.38 g/mol, XLogP of 4.40, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenyl-7H-acenaphthyleno[2,1-g]pteridin-11-imine is sourced from PubChem (CID 135429898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).