C33H25N3O6 — CID 135429949
N-[(Z)-1-(6,11-dioxo-1H-naphtho[2,3-e]benzimidazol-2-yl)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzamide (PubChem CID 135429949) has the molecular formula C33H25N3O6 and a molecular weight of 559.58 g/mol. Its IUPAC name is N-[(Z)-1-(6,11-dioxo-1H-naphtho[2,3-e]benzimidazol-2-yl)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzamide.
| Compound Name | N-[(Z)-1-(6,11-dioxo-1H-naphtho[2,3-e]benzimidazol-2-yl)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzamide |
|---|---|
| PubChem CID | 135429949 |
| Molecular Formula | C33H25N3O6 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | N-[(Z)-1-(6,11-dioxo-1H-naphtho[2,3-e]benzimidazol-2-yl)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzamide |
| SMILES | COc1cc(/C=C(\NC(=O)c2ccccc2)c2nc3ccc4c(c3[nH]2)C(=O)c2ccccc2C4=O)cc(OC)c1OC |
| InChI | InChI=1S/C33H25N3O6/c1-40-25-16-18(17-26(41-2)31(25)42-3)15-24(35-33(39)19-9-5-4-6-10-19)32-34-23-14-13-22-27(28(23)36-32)30(38)21-12-8-7-11-20(21)29(22)37/h4-17H,1-3H3,(H,34,36)(H,35,39)/b24-15- |
| InChIKey | UTXKAEJVXOAKIN-IWIPYMOSSA-N |
| XLogP | 5.29 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|