About 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea
1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea (PubChem CID 135430091) has the molecular formula C13H16N4OS
and a molecular weight of 276.37 g/mol. Its IUPAC name is 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea.
Molecular Properties
| Compound Name | 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea |
| PubChem CID | 135430091 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea |
| SMILES | CCc1ccc2c(c1)C(=NN(C)C(=S)NC)C(=O)N2 |
| InChI | InChI=1S/C13H16N4OS/c1-4-8-5-6-10-9(7-8)11(12(18)15-10)16-17(3)13(19)14-2/h5-7H,4H2,1-3H3,(H,14,19)(H,15,16,18) |
| InChIKey | IKPWTAPUHZTEEW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea?
The IUPAC name of 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea (CID 135430091) is 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea.
What is the SMILES notation for 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea?
The canonical SMILES for 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea is CCc1ccc2c(c1)C(=NN(C)C(=S)NC)C(=O)N2.
What is the InChIKey of 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea?
The InChIKey is IKPWTAPUHZTEEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4OS/c1-4-8-5-6-10-9(7-8)11(12(18)15-10)16-17(3)13(19)14-2/h5-7H,4H2,1-3H3,(H,14,19)(H,15,16,18).
What are the key properties of 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea?
1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea has a molecular weight of 276.37 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-ethyl-2-oxo-1H-indol-3-ylidene)amino]-1,3-dimethylthiourea is sourced from PubChem (CID 135430091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).