About 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate (PubChem CID 135430120) has the molecular formula C17H15FN2O4S
and a molecular weight of 362.38 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate.
Molecular Properties
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate |
| PubChem CID | 135430120 |
| Molecular Formula | C17H15FN2O4S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate |
| SMILES | O=C(OCCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1F |
| InChI | InChI=1S/C17H15FN2O4S/c18-14-8-3-1-6-12(14)17(21)24-11-5-10-19-16-13-7-2-4-9-15(13)25(22,23)20-16/h1-4,6-9H,5,10-11H2,(H,19,20) |
| InChIKey | AYUIDKBHNWUPDS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate?
The IUPAC name of 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate (CID 135430120) is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate.
What is the SMILES notation for 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate?
The canonical SMILES for 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate is O=C(OCCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1F.
What is the InChIKey of 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate?
The InChIKey is AYUIDKBHNWUPDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN2O4S/c18-14-8-3-1-6-12(14)17(21)24-11-5-10-19-16-13-7-2-4-9-15(13)25(22,23)20-16/h1-4,6-9H,5,10-11H2,(H,19,20).
What are the key properties of 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate?
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate has a molecular weight of 362.38 g/mol, XLogP of 2.11, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-fluorobenzoate is sourced from PubChem (CID 135430120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).