About 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol
4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol (PubChem CID 135430134) has the molecular formula C25H24N2O
and a molecular weight of 368.48 g/mol. Its IUPAC name is 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol.
Molecular Properties
| Compound Name | 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol |
| PubChem CID | 135430134 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol |
| SMILES | CC(C)Cc1c(-c2ccccc2)nn(-c2ccccc2)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C25H24N2O/c1-18(2)17-23-24(19-9-5-3-6-10-19)26-27(21-11-7-4-8-12-21)25(23)20-13-15-22(28)16-14-20/h3-16,18,28H,17H2,1-2H3 |
| InChIKey | HDNPBLWYXSVUFK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol?
The IUPAC name of 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol (CID 135430134) is 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol.
What is the SMILES notation for 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol?
The canonical SMILES for 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol is CC(C)Cc1c(-c2ccccc2)nn(-c2ccccc2)c1-c1ccc(O)cc1.
What is the InChIKey of 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol?
The InChIKey is HDNPBLWYXSVUFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O/c1-18(2)17-23-24(19-9-5-3-6-10-19)26-27(21-11-7-4-8-12-21)25(23)20-13-15-22(28)16-14-20/h3-16,18,28H,17H2,1-2H3.
What are the key properties of 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol?
4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol has a molecular weight of 368.48 g/mol, XLogP of 6.11, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-methylpropyl)-1,3-diphenylpyrazol-5-yl]phenol is sourced from PubChem (CID 135430134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).