C26H19N5O3S — CID 135430380
(2E,5E)-5-[(2-methoxyphenyl)methylidene]-2-[(E)-(4-oxo-3-phenylquinazolin-2-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135430380) has the molecular formula C26H19N5O3S and a molecular weight of 481.54 g/mol. Its IUPAC name is (2E,5E)-5-[(2-methoxyphenyl)methylidene]-2-[(E)-(4-oxo-3-phenylquinazolin-2-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-5-[(2-methoxyphenyl)methylidene]-2-[(E)-(4-oxo-3-phenylquinazolin-2-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135430380 |
| Molecular Formula | C26H19N5O3S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (2E,5E)-5-[(2-methoxyphenyl)methylidene]-2-[(E)-(4-oxo-3-phenylquinazolin-2-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1/C=C1/S/C(=N/N=C/c2nc3ccccc3c(=O)n2-c2ccccc2)NC1=O |
| InChI | InChI=1S/C26H19N5O3S/c1-34-21-14-8-5-9-17(21)15-22-24(32)29-26(35-22)30-27-16-23-28-20-13-7-6-12-19(20)25(33)31(23)18-10-3-2-4-11-18/h2-16H,1H3,(H,29,30,32)/b22-15+,27-16+ |
| InChIKey | IVZXCPQWCKEMMU-QHPKCYJTSA-N |
| XLogP | 3.99 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|