C27H35ClN2O6 — CID 135430411
2-[4-[(2-amino-2-oxoethyl)iminomethyl]-2-chloro-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenoxy]acetic acid (PubChem CID 135430411) has the molecular formula C27H35ClN2O6 and a molecular weight of 519.04 g/mol. Its IUPAC name is 2-[4-[(2-amino-2-oxoethyl)iminomethyl]-2-chloro-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(2-amino-2-oxoethyl)iminomethyl]-2-chloro-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 135430411 |
| Molecular Formula | C27H35ClN2O6 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-[4-[(2-amino-2-oxoethyl)iminomethyl]-2-chloro-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenoxy]acetic acid |
| SMILES | CC(/C=C/[C@@]1(C)[C@H](C)CCC(=O)[C@@H]1C)=C\Cc1c(O)c(/C=N/CC(N)=O)c(C)c(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C27H35ClN2O6/c1-15(10-11-27(5)16(2)7-9-21(31)18(27)4)6-8-19-25(35)20(12-30-13-22(29)32)17(3)24(28)26(19)36-14-23(33)34/h6,10-12,16,18,35H,7-9,13-14H2,1-5H3,(H2,29,32)(H,33,34)/b11-10+,15-6+,30-12+/t16-,18+,27+/m1/s1 |
| InChIKey | YXQZKWZUQCCFJS-VRZBTGSGSA-N |
| XLogP | 4.41 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|