C12H18F2N5O4P — CID 135430577
[7-(6-amino-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)-1,1-difluoroheptyl]phosphonic acid (PubChem CID 135430577) has the molecular formula C12H18F2N5O4P and a molecular weight of 365.28 g/mol. Its IUPAC name is [7-(6-amino-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)-1,1-difluoroheptyl]phosphonic acid.
| Compound Name | [7-(6-amino-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)-1,1-difluoroheptyl]phosphonic acid |
|---|---|
| PubChem CID | 135430577 |
| Molecular Formula | C12H18F2N5O4P |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [7-(6-amino-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)-1,1-difluoroheptyl]phosphonic acid |
| SMILES | Nc1nc2c(cnn2CCCCCCC(F)(F)P(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C12H18F2N5O4P/c13-12(14,24(21,22)23)5-3-1-2-4-6-19-9-8(7-16-19)10(20)18-11(15)17-9/h7H,1-6H2,(H2,21,22,23)(H3,15,17,18,20) |
| InChIKey | FTKHQGLMGNXAPK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|