C25H22FN5O2S — CID 135430777
4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-2-fluoro-N-(1,3-thiazol-5-ylmethyl)benzamide (PubChem CID 135430777) has the molecular formula C25H22FN5O2S and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-2-fluoro-N-(1,3-thiazol-5-ylmethyl)benzamide.
| Compound Name | 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-2-fluoro-N-(1,3-thiazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 135430777 |
| Molecular Formula | C25H22FN5O2S |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-2-fluoro-N-(1,3-thiazol-5-ylmethyl)benzamide |
| SMILES | C#CCN(Cc1cc2c(=O)[nH]c(C)nc2cc1C)c1ccc(C(=O)NCc2cncs2)c(F)c1 |
| InChI | InChI=1S/C25H22FN5O2S/c1-4-7-31(13-17-9-21-23(8-15(17)2)29-16(3)30-25(21)33)18-5-6-20(22(26)10-18)24(32)28-12-19-11-27-14-34-19/h1,5-6,8-11,14H,7,12-13H2,2-3H3,(H,28,32)(H,29,30,33) |
| InChIKey | RRZRVGRSEJDOSI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|