About Calcium Folinate
Calcium Folinate (PubChem CID 135430945) has the molecular formula C20H23CaN7O7
and a molecular weight of 513.52 g/mol.
Molecular Properties
| Compound Name | Calcium Folinate |
| PubChem CID | 135430945 |
| Molecular Formula | C20H23CaN7O7 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(c(=O)[nH]1)N(C=O)C(CNc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)CN2.[Ca] |
| InChI | InChI=1S/C20H23N7O7.Ca/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30;/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32);/t12?,13-;/m0./s1 |
| InChIKey | BZPWXVJDMRBCMD-ZEDZUCNESA-N |
| XLogP | -1.11 |
| TPSA | 219.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze Calcium Folinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Calcium Folinate?
The IUPAC name of Calcium Folinate (CID 135430945) is not available.
What is the SMILES notation for Calcium Folinate?
The canonical SMILES for Calcium Folinate is Nc1nc2c(c(=O)[nH]1)N(C=O)C(CNc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)CN2.[Ca].
What is the InChIKey of Calcium Folinate?
The InChIKey is BZPWXVJDMRBCMD-ZEDZUCNESA-N. The full InChI is InChI=1S/C20H23N7O7.Ca/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30;/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32);/t12?,13-;/m0./s1.
What are the key properties of Calcium Folinate?
Calcium Folinate has a molecular weight of 513.52 g/mol, XLogP of -1.11, 10 rotatable bonds, 7 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for Calcium Folinate is sourced from PubChem (CID 135430945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).